Dodecanedioic acid

Dodecanedioic acid

Names
IUPAC name dodecanedioic acid
Identifiers
CAS Number	693-23-2 Y
ChEBI	CHEBI:4676 Y
ChemSpider	12213 Y
Jmol 3D model	Interactive image
KEGG	C02678 Y
PubChem	12736
InChI InChI=1S/C12H22O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1-10H2,(H,13,14)(H,15,16) Y Key: TVIDDXQYHWJXFK-UHFFFAOYSA-N Y InChI=1/C12H22O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h1-10H2,(H,13,14)(H,15,16) Key: TVIDDXQYHWJXFK-UHFFFAOYAC
SMILES O=C(O)CCCCCCCCCCC(=O)O
Properties
Chemical formula	C12H22O4
Molar mass	230.30 g·mol−1
Appearance	white flakes
Density	1.066g/cm3
Melting point	127 to 129 °C (261 to 264 °F; 400 to 402 K)
Boiling point	245 °C (473 °F; 518 K)
Solubility in water	pH dependent
Vapor pressure	{{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Y verify (what is YN ?)
Infobox references

Dodecanedioic acid informally referred to as DDDA is a dicarboxylic acid mainly used in antiseptics, top-grade coatings, painting materials, corrosion inhibitor, surfactant, and engineering plastics such as nylon 612.

Experimental work with Dodecanedioic acid in type 2 diabetic patients has demonstrated that IV infusion helps to maintain normal blood sugar and energy levels without increasing the blood glucose load in the process.